C16H16F3NS — CID 63477350
N-[cyclopentyl(thiophen-2-yl)methyl]-2,3,5-trifluoroaniline (PubChem CID 63477350) has the molecular formula C16H16F3NS and a molecular weight of 311.37 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-2,3,5-trifluoroaniline.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 63477350 |
| Molecular Formula | C16H16F3NS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-2,3,5-trifluoroaniline |
| SMILES | Fc1cc(F)c(F)c(NC(c2cccs2)C2CCCC2)c1 |
| InChI | InChI=1S/C16H16F3NS/c17-11-8-12(18)15(19)13(9-11)20-16(10-4-1-2-5-10)14-6-3-7-21-14/h3,6-10,16,20H,1-2,4-5H2 |
| InChIKey | HJWKNWUIBJZFCN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|