C16H16BrF2NS — CID 107609695
4-bromo-N-[cyclopentyl(thiophen-2-yl)methyl]-2,5-difluoroaniline (PubChem CID 107609695) has the molecular formula C16H16BrF2NS and a molecular weight of 372.28 g/mol. Its IUPAC name is 4-bromo-N-[cyclopentyl(thiophen-2-yl)methyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[cyclopentyl(thiophen-2-yl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609695 |
| Molecular Formula | C16H16BrF2NS |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-bromo-N-[cyclopentyl(thiophen-2-yl)methyl]-2,5-difluoroaniline |
| SMILES | Fc1cc(NC(c2cccs2)C2CCCC2)c(F)cc1Br |
| InChI | InChI=1S/C16H16BrF2NS/c17-11-8-13(19)14(9-12(11)18)20-16(10-4-1-2-5-10)15-6-3-7-21-15/h3,6-10,16,20H,1-2,4-5H2 |
| InChIKey | XGLMLFFFLCKWLQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|