C22H21NO3S — CID 101208168
4-methoxy-N-[(R)-(4-methylphenyl)-[(2S)-3-oxo-1,3λ4-benzoxathiol-2-yl]methyl]aniline (PubChem CID 101208168) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-methoxy-N-[(R)-(4-methylphenyl)-[(2S)-3-oxo-1,3λ4-benzoxathiol-2-yl]methyl]aniline.
| Compound Name | 4-methoxy-N-[(R)-(4-methylphenyl)-[(2S)-3-oxo-1,3λ4-benzoxathiol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 101208168 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-methoxy-N-[(R)-(4-methylphenyl)-[(2S)-3-oxo-1,3λ4-benzoxathiol-2-yl]methyl]aniline |
| SMILES | COc1ccc(N[C@H](c2ccc(C)cc2)[C@H]2Oc3ccccc3S2=O)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-15-7-9-16(10-8-15)21(23-17-11-13-18(25-2)14-12-17)22-26-19-5-3-4-6-20(19)27(22)24/h3-14,21-23H,1-2H3/t21-,22+,27?/m1/s1 |
| InChIKey | RDRBYHSYVODOSG-OCTGXNKJSA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|