C19H23NO3 — CID 162409373
N-[1,4-dioxan-2-yl-(4-methylphenyl)methyl]-4-methoxyaniline (PubChem CID 162409373) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[1,4-dioxan-2-yl-(4-methylphenyl)methyl]-4-methoxyaniline.
| Compound Name | N-[1,4-dioxan-2-yl-(4-methylphenyl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 162409373 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[1,4-dioxan-2-yl-(4-methylphenyl)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC(c2ccc(C)cc2)C2COCCO2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-14-3-5-15(6-4-14)19(18-13-22-11-12-23-18)20-16-7-9-17(21-2)10-8-16/h3-10,18-20H,11-13H2,1-2H3 |
| InChIKey | WXQXOWNRFBXAPC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|