C11H14F3NO — CID 92974659
(2S)-2-methoxy-N-methyl-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 92974659) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is (2S)-2-methoxy-N-methyl-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | (2S)-2-methoxy-N-methyl-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 92974659 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (2S)-2-methoxy-N-methyl-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CNC[C@@H](OC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c1-15-7-10(16-2)8-3-5-9(6-4-8)11(12,13)14/h3-6,10,15H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | UICBGUOBHTYPNV-SNVBAGLBSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |