C16H16F4NO3P — CID 2067070
N-[(R)-dimethoxyphosphoryl-(4-fluorophenyl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 2067070) has the molecular formula C16H16F4NO3P and a molecular weight of 377.27 g/mol. Its IUPAC name is N-[(R)-dimethoxyphosphoryl-(4-fluorophenyl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(R)-dimethoxyphosphoryl-(4-fluorophenyl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2067070 |
| Molecular Formula | C16H16F4NO3P |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[(R)-dimethoxyphosphoryl-(4-fluorophenyl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | COP(=O)(OC)[C@@H](Nc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F4NO3P/c1-23-25(22,24-2)15(11-6-8-13(17)9-7-11)21-14-5-3-4-12(10-14)16(18,19)20/h3-10,15,21H,1-2H3/t15-/m1/s1 |
| InChIKey | LBWCPQUBOGZPEI-OAHLLOKOSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|