C18H19F4N2O3P — CID 4152791
N-[[diethoxyphosphoryl-(4-fluorophenyl)methylidene]amino]-3-(trifluoromethyl)aniline (PubChem CID 4152791) has the molecular formula C18H19F4N2O3P and a molecular weight of 418.33 g/mol. Its IUPAC name is N-[[diethoxyphosphoryl-(4-fluorophenyl)methylidene]amino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[[diethoxyphosphoryl-(4-fluorophenyl)methylidene]amino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4152791 |
| Molecular Formula | C18H19F4N2O3P |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[[diethoxyphosphoryl-(4-fluorophenyl)methylidene]amino]-3-(trifluoromethyl)aniline |
| SMILES | CCOP(=O)(OCC)C(=NNc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F4N2O3P/c1-3-26-28(25,27-4-2)17(13-8-10-15(19)11-9-13)24-23-16-7-5-6-14(12-16)18(20,21)22/h5-12,23H,3-4H2,1-2H3 |
| InChIKey | GACKBYYMSXEQRQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|