C21H22N3O3P — CID 139059162
ethoxy-[(S)-phenyl-(4-phenyldiazenylanilino)methyl]phosphinic acid (PubChem CID 139059162) has the molecular formula C21H22N3O3P and a molecular weight of 395.40 g/mol. Its IUPAC name is ethoxy-[(S)-phenyl-(4-phenyldiazenylanilino)methyl]phosphinic acid.
| Compound Name | ethoxy-[(S)-phenyl-(4-phenyldiazenylanilino)methyl]phosphinic acid |
|---|---|
| PubChem CID | 139059162 |
| Molecular Formula | C21H22N3O3P |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethoxy-[(S)-phenyl-(4-phenyldiazenylanilino)methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)[C@H](Nc1ccc(/N=N/c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N3O3P/c1-2-27-28(25,26)21(17-9-5-3-6-10-17)22-18-13-15-20(16-14-18)24-23-19-11-7-4-8-12-19/h3-16,21-22H,2H2,1H3,(H,25,26)/b24-23+/t21-/m0/s1 |
| InChIKey | VHBRKHRWJZPESZ-ZGBROZEESA-N |
| XLogP | 6.43 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|