C19H26NO5P — CID 22310127
[anilino-(4-ethoxyphenyl)methyl]-(3-hydroxybutan-2-yloxy)phosphinic acid (PubChem CID 22310127) has the molecular formula C19H26NO5P and a molecular weight of 379.39 g/mol. Its IUPAC name is [anilino-(4-ethoxyphenyl)methyl]-(3-hydroxybutan-2-yloxy)phosphinic acid.
| Compound Name | [anilino-(4-ethoxyphenyl)methyl]-(3-hydroxybutan-2-yloxy)phosphinic acid |
|---|---|
| PubChem CID | 22310127 |
| Molecular Formula | C19H26NO5P |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [anilino-(4-ethoxyphenyl)methyl]-(3-hydroxybutan-2-yloxy)phosphinic acid |
| SMILES | CCOc1ccc(C(Nc2ccccc2)P(=O)(O)OC(C)C(C)O)cc1 |
| InChI | InChI=1S/C19H26NO5P/c1-4-24-18-12-10-16(11-13-18)19(20-17-8-6-5-7-9-17)26(22,23)25-15(3)14(2)21/h5-15,19-21H,4H2,1-3H3,(H,22,23) |
| InChIKey | CZZKTGOJPXRNFT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|