C19H26NO4PS — CID 3989092
3-[[anilino-(4-ethoxyphenyl)methyl]-hydroxyphosphinothioyl]oxybutan-2-ol (PubChem CID 3989092) has the molecular formula C19H26NO4PS and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[[anilino-(4-ethoxyphenyl)methyl]-hydroxyphosphinothioyl]oxybutan-2-ol.
| Compound Name | 3-[[anilino-(4-ethoxyphenyl)methyl]-hydroxyphosphinothioyl]oxybutan-2-ol |
|---|---|
| PubChem CID | 3989092 |
| Molecular Formula | C19H26NO4PS |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[[anilino-(4-ethoxyphenyl)methyl]-hydroxyphosphinothioyl]oxybutan-2-ol |
| SMILES | CCOc1ccc(C(Nc2ccccc2)P(O)(=S)OC(C)C(C)O)cc1 |
| InChI | InChI=1S/C19H26NO4PS/c1-4-23-18-12-10-16(11-13-18)19(20-17-8-6-5-7-9-17)25(22,26)24-15(3)14(2)21/h5-15,19-21H,4H2,1-3H3,(H,22,26) |
| InChIKey | KGDFURLPVXWMDG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|