C28H34N2O — CID 69017314
(2S,3R)-4-amino-2-(dibenzylamino)-1-phenyloct-7-en-3-ol (PubChem CID 69017314) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is (2S,3R)-4-amino-2-(dibenzylamino)-1-phenyloct-7-en-3-ol.
| Compound Name | (2S,3R)-4-amino-2-(dibenzylamino)-1-phenyloct-7-en-3-ol |
|---|---|
| PubChem CID | 69017314 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (2S,3R)-4-amino-2-(dibenzylamino)-1-phenyloct-7-en-3-ol |
| SMILES | C=CCCC(N)[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H34N2O/c1-2-3-19-26(29)28(31)27(20-23-13-7-4-8-14-23)30(21-24-15-9-5-10-16-24)22-25-17-11-6-12-18-25/h2,4-18,26-28,31H,1,3,19-22,29H2/t26?,27-,28+/m0/s1 |
| InChIKey | ADFDCLZMYOUCFM-GUQXXGRISA-N |
| XLogP | 4.95 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|