C26H30N2O — CID 118347056
(2S,3S,4S)-2-(dibenzylamino)-4-methyl-1-pyridin-3-ylhex-5-en-3-ol (PubChem CID 118347056) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S,3S,4S)-2-(dibenzylamino)-4-methyl-1-pyridin-3-ylhex-5-en-3-ol.
| Compound Name | (2S,3S,4S)-2-(dibenzylamino)-4-methyl-1-pyridin-3-ylhex-5-en-3-ol |
|---|---|
| PubChem CID | 118347056 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (2S,3S,4S)-2-(dibenzylamino)-4-methyl-1-pyridin-3-ylhex-5-en-3-ol |
| SMILES | C=C[C@H](C)[C@H](O)[C@H](Cc1cccnc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2O/c1-3-21(2)26(29)25(17-24-15-10-16-27-18-24)28(19-22-11-6-4-7-12-22)20-23-13-8-5-9-14-23/h3-16,18,21,25-26,29H,1,17,19-20H2,2H3/t21-,25-,26-/m0/s1 |
| InChIKey | RWRIWYYTUHASLG-MZBJOSPHSA-N |
| XLogP | 4.88 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|