C20H34N2 — CID 142160698
N'-benzyl-N'-[(Z)-2-butan-2-ylpent-3-enyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 142160698) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N'-benzyl-N'-[(Z)-2-butan-2-ylpent-3-enyl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-[(Z)-2-butan-2-ylpent-3-enyl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142160698 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | N'-benzyl-N'-[(Z)-2-butan-2-ylpent-3-enyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | C/C=C\C(CN(CCN(C)C)Cc1ccccc1)C(C)CC |
| InChI | InChI=1S/C20H34N2/c1-6-11-20(18(3)7-2)17-22(15-14-21(4)5)16-19-12-9-8-10-13-19/h6,8-13,18,20H,7,14-17H2,1-5H3/b11-6- |
| InChIKey | JSPZXHWOKLDPHH-WDZFZDKYSA-N |
| XLogP | 4.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|