C20H23OP — CID 25111722
[octa-1,2-dienyl(phenyl)phosphoryl]benzene (PubChem CID 25111722) has the molecular formula C20H23OP and a molecular weight of 310.38 g/mol. Its IUPAC name is [octa-1,2-dienyl(phenyl)phosphoryl]benzene.
| Compound Name | [octa-1,2-dienyl(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 25111722 |
| Molecular Formula | C20H23OP |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [octa-1,2-dienyl(phenyl)phosphoryl]benzene |
| SMILES | CCCCCC=C=CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23OP/c1-2-3-4-5-6-13-18-22(21,19-14-9-7-10-15-19)20-16-11-8-12-17-20/h6-12,14-18H,2-5H2,1H3 |
| InChIKey | XFQOJSWKFMXKES-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|