C13H16OS — CID 11470056
hepta-1,2-dienylsulfinylbenzene (PubChem CID 11470056) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is hepta-1,2-dienylsulfinylbenzene.
| Compound Name | hepta-1,2-dienylsulfinylbenzene |
|---|---|
| PubChem CID | 11470056 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | hepta-1,2-dienylsulfinylbenzene |
| SMILES | CCCCC=C=CS(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16OS/c1-2-3-4-5-9-12-15(14)13-10-7-6-8-11-13/h5-8,10-12H,2-4H2,1H3 |
| InChIKey | ZDLIVRQGSNTQTI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|