C15H12OS — CID 71447124
3-(benzenesulfinyl)propa-1,2-dienylbenzene (PubChem CID 71447124) has the molecular formula C15H12OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-(benzenesulfinyl)propa-1,2-dienylbenzene.
| Compound Name | 3-(benzenesulfinyl)propa-1,2-dienylbenzene |
|---|---|
| PubChem CID | 71447124 |
| Molecular Formula | C15H12OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(benzenesulfinyl)propa-1,2-dienylbenzene |
| SMILES | O=S(C=C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12OS/c16-17(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-6,8-13H |
| InChIKey | WXXJIBIWMGYCAR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |