About 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone
1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone (PubChem CID 102318435) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone |
| PubChem CID | 102318435 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C=C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H14O/c1-14(18)17-12-10-16(11-13-17)9-5-8-15-6-3-2-4-7-15/h2-4,6-13H,1H3 |
| InChIKey | ULUUPQSEILOGCT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone?
The IUPAC name of 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone (CID 102318435) is 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone.
What is the SMILES notation for 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone?
The canonical SMILES for 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone is CC(=O)c1ccc(C=C=Cc2ccccc2)cc1.
What is the InChIKey of 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone?
The InChIKey is ULUUPQSEILOGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c1-14(18)17-12-10-16(11-13-17)9-5-8-15-6-3-2-4-7-15/h2-4,6-13H,1H3.
What are the key properties of 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone?
1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone has a molecular weight of 234.30 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-phenylpropa-1,2-dienyl)phenyl]ethanone is sourced from PubChem (CID 102318435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).