About N-(3-phenylpropa-1,2-dienyl)aniline
N-(3-phenylpropa-1,2-dienyl)aniline (PubChem CID 176540019) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is N-(3-phenylpropa-1,2-dienyl)aniline.
Molecular Properties
| Compound Name | N-(3-phenylpropa-1,2-dienyl)aniline |
| PubChem CID | 176540019 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-(3-phenylpropa-1,2-dienyl)aniline |
| SMILES | C(=CNc1ccccc1)=Cc1ccccc1 |
| InChI | InChI=1S/C15H13N/c1-3-8-14(9-4-1)10-7-13-16-15-11-5-2-6-12-15/h1-6,8-13,16H |
| InChIKey | PJIQXLNJOJPHBE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3-phenylpropa-1,2-dienyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-phenylpropa-1,2-dienyl)aniline?
The IUPAC name of N-(3-phenylpropa-1,2-dienyl)aniline (CID 176540019) is N-(3-phenylpropa-1,2-dienyl)aniline.
What is the SMILES notation for N-(3-phenylpropa-1,2-dienyl)aniline?
The canonical SMILES for N-(3-phenylpropa-1,2-dienyl)aniline is C(=CNc1ccccc1)=Cc1ccccc1.
What is the InChIKey of N-(3-phenylpropa-1,2-dienyl)aniline?
The InChIKey is PJIQXLNJOJPHBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-3-8-14(9-4-1)10-7-13-16-15-11-5-2-6-12-15/h1-6,8-13,16H.
What are the key properties of N-(3-phenylpropa-1,2-dienyl)aniline?
N-(3-phenylpropa-1,2-dienyl)aniline has a molecular weight of 207.28 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-phenylpropa-1,2-dienyl)aniline is sourced from PubChem (CID 176540019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).