C10H7F4N — CID 176544530
N-(3,4,4,4-tetrafluorobuta-1,2-dienyl)aniline (PubChem CID 176544530) has the molecular formula C10H7F4N and a molecular weight of 217.17 g/mol. Its IUPAC name is N-(3,4,4,4-tetrafluorobuta-1,2-dienyl)aniline.
| Compound Name | N-(3,4,4,4-tetrafluorobuta-1,2-dienyl)aniline |
|---|---|
| PubChem CID | 176544530 |
| Molecular Formula | C10H7F4N |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | N-(3,4,4,4-tetrafluorobuta-1,2-dienyl)aniline |
| SMILES | FC(=C=CNc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H7F4N/c11-9(10(12,13)14)6-7-15-8-4-2-1-3-5-8/h1-5,7,15H |
| InChIKey | YNCADIUWWYJMGZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |