About 4-(benzenesulfinyl)buta-1,3-dienylbenzene
4-(benzenesulfinyl)buta-1,3-dienylbenzene (PubChem CID 72756067) has the molecular formula C16H14OS
and a molecular weight of 254.35 g/mol. Its IUPAC name is 4-(benzenesulfinyl)buta-1,3-dienylbenzene.
Molecular Properties
| Compound Name | 4-(benzenesulfinyl)buta-1,3-dienylbenzene |
| PubChem CID | 72756067 |
| Molecular Formula | C16H14OS |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-(benzenesulfinyl)buta-1,3-dienylbenzene |
| SMILES | O=S(C=CC=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14OS/c17-18(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H |
| InChIKey | CXUHCOXHJOMDIX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzenesulfinyl)buta-1,3-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfinyl)buta-1,3-dienylbenzene?
The IUPAC name of 4-(benzenesulfinyl)buta-1,3-dienylbenzene (CID 72756067) is 4-(benzenesulfinyl)buta-1,3-dienylbenzene.
What is the SMILES notation for 4-(benzenesulfinyl)buta-1,3-dienylbenzene?
The canonical SMILES for 4-(benzenesulfinyl)buta-1,3-dienylbenzene is O=S(C=CC=Cc1ccccc1)c1ccccc1.
What is the InChIKey of 4-(benzenesulfinyl)buta-1,3-dienylbenzene?
The InChIKey is CXUHCOXHJOMDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS/c17-18(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H.
What are the key properties of 4-(benzenesulfinyl)buta-1,3-dienylbenzene?
4-(benzenesulfinyl)buta-1,3-dienylbenzene has a molecular weight of 254.35 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfinyl)buta-1,3-dienylbenzene is sourced from PubChem (CID 72756067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).