C9H7F3OS — CID 134889626
[(S)-[(Z)-3,3,3-trifluoroprop-1-enyl]sulfinyl]benzene (PubChem CID 134889626) has the molecular formula C9H7F3OS and a molecular weight of 220.22 g/mol. Its IUPAC name is [(S)-[(Z)-3,3,3-trifluoroprop-1-enyl]sulfinyl]benzene.
| Compound Name | [(S)-[(Z)-3,3,3-trifluoroprop-1-enyl]sulfinyl]benzene |
|---|---|
| PubChem CID | 134889626 |
| Molecular Formula | C9H7F3OS |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | [(S)-[(Z)-3,3,3-trifluoroprop-1-enyl]sulfinyl]benzene |
| SMILES | O=[S@@](/C=C\C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H7F3OS/c10-9(11,12)6-7-14(13)8-4-2-1-3-5-8/h1-7H/b7-6-/t14-/m0/s1 |
| InChIKey | UODUPLDJVVBBBW-AFNCTOJWSA-N |
| XLogP | 2.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |