C20H22OS — CID 174688348
1-(benzenesulfinyl)octa-2,3-dienylbenzene (PubChem CID 174688348) has the molecular formula C20H22OS and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-(benzenesulfinyl)octa-2,3-dienylbenzene.
| Compound Name | 1-(benzenesulfinyl)octa-2,3-dienylbenzene |
|---|---|
| PubChem CID | 174688348 |
| Molecular Formula | C20H22OS |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-(benzenesulfinyl)octa-2,3-dienylbenzene |
| SMILES | CCCCC=C=CC(c1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22OS/c1-2-3-4-5-12-17-20(18-13-8-6-9-14-18)22(21)19-15-10-7-11-16-19/h5-11,13-17,20H,2-4H2,1H3 |
| InChIKey | WXPHDDPFQVQGHQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|