C13H16O — CID 101070006
1-phenylhepta-2,3-dien-1-ol (PubChem CID 101070006) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-phenylhepta-2,3-dien-1-ol.
| Compound Name | 1-phenylhepta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 101070006 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-phenylhepta-2,3-dien-1-ol |
| SMILES | CCCC=C=CC(O)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h4-7,9-11,13-14H,2-3H2,1H3 |
| InChIKey | WEGYEFAEYWSNGK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |