C18H17ClO — CID 132573540
1-(4-chlorophenyl)-4-phenylhexa-2,3-dien-1-ol (PubChem CID 132573540) has the molecular formula C18H17ClO and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-phenylhexa-2,3-dien-1-ol.
| Compound Name | 1-(4-chlorophenyl)-4-phenylhexa-2,3-dien-1-ol |
|---|---|
| PubChem CID | 132573540 |
| Molecular Formula | C18H17ClO |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(4-chlorophenyl)-4-phenylhexa-2,3-dien-1-ol |
| SMILES | CCC(=C=CC(O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17ClO/c1-2-14(15-6-4-3-5-7-15)10-13-18(20)16-8-11-17(19)12-9-16/h3-9,11-13,18,20H,2H2,1H3 |
| InChIKey | OLOWEWFLNUYEGB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |