C18H19ClO — CID 122212959
(E,1S)-1-(4-chlorophenyl)-3-methyl-5-phenylpent-2-en-1-ol (PubChem CID 122212959) has the molecular formula C18H19ClO and a molecular weight of 286.80 g/mol. Its IUPAC name is (E,1S)-1-(4-chlorophenyl)-3-methyl-5-phenylpent-2-en-1-ol.
| Compound Name | (E,1S)-1-(4-chlorophenyl)-3-methyl-5-phenylpent-2-en-1-ol |
|---|---|
| PubChem CID | 122212959 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (E,1S)-1-(4-chlorophenyl)-3-methyl-5-phenylpent-2-en-1-ol |
| SMILES | C/C(=C\[C@H](O)c1ccc(Cl)cc1)CCc1ccccc1 |
| InChI | InChI=1S/C18H19ClO/c1-14(7-8-15-5-3-2-4-6-15)13-18(20)16-9-11-17(19)12-10-16/h2-6,9-13,18,20H,7-8H2,1H3/b14-13+/t18-/m0/s1 |
| InChIKey | NXIHMIYZXJJDRA-JKGDOXCYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|