C16H24OSi — CID 13211418
1-phenyl-2-trimethylsilylhepta-2,3-dien-1-ol (PubChem CID 13211418) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is 1-phenyl-2-trimethylsilylhepta-2,3-dien-1-ol.
| Compound Name | 1-phenyl-2-trimethylsilylhepta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 13211418 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-phenyl-2-trimethylsilylhepta-2,3-dien-1-ol |
| SMILES | CCCC=C=C(C(O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H24OSi/c1-5-6-8-13-15(18(2,3)4)16(17)14-11-9-7-10-12-14/h7-12,16-17H,5-6H2,1-4H3 |
| InChIKey | CAIIGNFIJUATOW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|