C18H28O2Si — CID 177483276
(1R,5S)-5,6-dimethyl-1-phenyl-2-trimethylsilylhepta-2,3-diene-1,6-diol (PubChem CID 177483276) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (1R,5S)-5,6-dimethyl-1-phenyl-2-trimethylsilylhepta-2,3-diene-1,6-diol.
| Compound Name | (1R,5S)-5,6-dimethyl-1-phenyl-2-trimethylsilylhepta-2,3-diene-1,6-diol |
|---|---|
| PubChem CID | 177483276 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (1R,5S)-5,6-dimethyl-1-phenyl-2-trimethylsilylhepta-2,3-diene-1,6-diol |
| SMILES | C[C@@H](C=C=C([C@H](O)c1ccccc1)[Si](C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C18H28O2Si/c1-14(18(2,3)20)12-13-16(21(4,5)6)17(19)15-10-8-7-9-11-15/h7-12,14,17,19-20H,1-6H3/t13?,14-,17+/m0/s1 |
| InChIKey | TXJWLWLSNMVPGZ-XLGXCUCASA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|