C13H18OSi — CID 12653266
1-phenyl-2-trimethylsilylbuta-2,3-dien-1-ol (PubChem CID 12653266) has the molecular formula C13H18OSi and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-phenyl-2-trimethylsilylbuta-2,3-dien-1-ol.
| Compound Name | 1-phenyl-2-trimethylsilylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 12653266 |
| Molecular Formula | C13H18OSi |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-phenyl-2-trimethylsilylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(C(O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C13H18OSi/c1-5-12(15(2,3)4)13(14)11-9-7-6-8-10-11/h6-10,13-14H,1H2,2-4H3 |
| InChIKey | FTEIMMXKNUQJQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|