C21H27NOSi — CID 11739228
(2S)-2-phenyl-2-[[(1R)-1-phenyl-2-trimethylsilylbuta-2,3-dienyl]amino]ethanol (PubChem CID 11739228) has the molecular formula C21H27NOSi and a molecular weight of 337.54 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[[(1R)-1-phenyl-2-trimethylsilylbuta-2,3-dienyl]amino]ethanol.
| Compound Name | (2S)-2-phenyl-2-[[(1R)-1-phenyl-2-trimethylsilylbuta-2,3-dienyl]amino]ethanol |
|---|---|
| PubChem CID | 11739228 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-2-phenyl-2-[[(1R)-1-phenyl-2-trimethylsilylbuta-2,3-dienyl]amino]ethanol |
| SMILES | C=C=C([C@H](N[C@H](CO)c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C21H27NOSi/c1-5-20(24(2,3)4)21(18-14-10-7-11-15-18)22-19(16-23)17-12-8-6-9-13-17/h6-15,19,21-23H,1,16H2,2-4H3/t19-,21-/m1/s1 |
| InChIKey | JUQCASLJZTXAOG-TZIWHRDSSA-N |
| XLogP | 4.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|