C17H29NOSi — CID 102006794
(2S)-2-phenyl-2-[[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]amino]ethanol (PubChem CID 102006794) has the molecular formula C17H29NOSi and a molecular weight of 291.51 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]amino]ethanol.
| Compound Name | (2S)-2-phenyl-2-[[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 102006794 |
| Molecular Formula | C17H29NOSi |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (2S)-2-phenyl-2-[[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]amino]ethanol |
| SMILES | C=C[C@H]([C@@H](CC)N[C@H](CO)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C17H29NOSi/c1-6-15(17(7-2)20(3,4)5)18-16(13-19)14-11-9-8-10-12-14/h7-12,15-19H,2,6,13H2,1,3-5H3/t15-,16-,17-/m1/s1 |
| InChIKey | JNBXHQHNYGCPDT-BRWVUGGUSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|