C11H13NO — CID 130739533
2-methoxy-1-phenylbuta-2,3-dien-1-amine (PubChem CID 130739533) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-methoxy-1-phenylbuta-2,3-dien-1-amine.
| Compound Name | 2-methoxy-1-phenylbuta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 130739533 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-methoxy-1-phenylbuta-2,3-dien-1-amine |
| SMILES | C=C=C(OC)C(N)c1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-3-10(13-2)11(12)9-7-5-4-6-8-9/h4-8,11H,1,12H2,2H3 |
| InChIKey | MAJUYSZIPHJULY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|