C19H26N2O3 — CID 159907951
(1S)-1-amino-2-methyl-1-phenylpropan-2-ol;methyl (2S)-2-amino-2-phenylacetate (PubChem CID 159907951) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1S)-1-amino-2-methyl-1-phenylpropan-2-ol;methyl (2S)-2-amino-2-phenylacetate.
| Compound Name | (1S)-1-amino-2-methyl-1-phenylpropan-2-ol;methyl (2S)-2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 159907951 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1S)-1-amino-2-methyl-1-phenylpropan-2-ol;methyl (2S)-2-amino-2-phenylacetate |
| SMILES | CC(C)(O)[C@@H](N)c1ccccc1.COC(=O)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C10H15NO.C9H11NO2/c1-10(2,12)9(11)8-6-4-3-5-7-8;1-12-9(11)8(10)7-5-3-2-4-6-7/h3-7,9,12H,11H2,1-2H3;2-6,8H,10H2,1H3/t9-;8-/m00/s1 |
| InChIKey | NWUSUXMEQWGCNB-PVSSEACSSA-N |
| XLogP | 2.32 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |