About methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate
methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate (PubChem CID 158119010) has the molecular formula C25H26N2O4
and a molecular weight of 418.49 g/mol. Its IUPAC name is methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate.
Molecular Properties
| Compound Name | methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate |
| PubChem CID | 158119010 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate |
| SMILES | COC(=O)C(/N=C/c1ccccc1)c1ccccc1.COC(=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C16H15NO2.C9H11NO2/c1-19-16(18)15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13;1-12-9(11)8(10)7-5-3-2-4-6-7/h2-12,15H,1H3;2-6,8H,10H2,1H3/b17-12+; |
| InChIKey | FRJKFVYMYNICFD-KCUXUEJTSA-N |
| XLogP | 3.88 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate?
The IUPAC name of methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate (CID 158119010) is methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate.
What is the SMILES notation for methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate?
The canonical SMILES for methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate is COC(=O)C(/N=C/c1ccccc1)c1ccccc1.COC(=O)C(N)c1ccccc1.
What is the InChIKey of methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate?
The InChIKey is FRJKFVYMYNICFD-KCUXUEJTSA-N. The full InChI is InChI=1S/C16H15NO2.C9H11NO2/c1-19-16(18)15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13;1-12-9(11)8(10)7-5-3-2-4-6-7/h2-12,15H,1H3;2-6,8H,10H2,1H3/b17-12+;.
What are the key properties of methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate?
methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate has a molecular weight of 418.49 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-2-phenylacetate;methyl 2-(benzylideneamino)-2-phenylacetate is sourced from PubChem (CID 158119010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).