C29H32N2O4 — CID 160887386
methyl 2-amino-4-methyl-2-phenylpent-4-enoate;methyl 2-(benzylideneamino)-2-phenylacetate (PubChem CID 160887386) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is methyl 2-amino-4-methyl-2-phenylpent-4-enoate;methyl 2-(benzylideneamino)-2-phenylacetate.
| Compound Name | methyl 2-amino-4-methyl-2-phenylpent-4-enoate;methyl 2-(benzylideneamino)-2-phenylacetate |
|---|---|
| PubChem CID | 160887386 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | methyl 2-amino-4-methyl-2-phenylpent-4-enoate;methyl 2-(benzylideneamino)-2-phenylacetate |
| SMILES | C=C(C)CC(N)(C(=O)OC)c1ccccc1.COC(=O)C(/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15NO2.C13H17NO2/c1-19-16(18)15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13;1-10(2)9-13(14,12(15)16-3)11-7-5-4-6-8-11/h2-12,15H,1H3;4-8H,1,9,14H2,2-3H3/b17-12+; |
| InChIKey | SNUYFWKNVOWNMN-KCUXUEJTSA-N |
| XLogP | 5.00 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|