C25H23NO2 — CID 102321894
2-methylprop-2-enyl 2-(benzylideneamino)-2,2-diphenylacetate (PubChem CID 102321894) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-(benzylideneamino)-2,2-diphenylacetate.
| Compound Name | 2-methylprop-2-enyl 2-(benzylideneamino)-2,2-diphenylacetate |
|---|---|
| PubChem CID | 102321894 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-methylprop-2-enyl 2-(benzylideneamino)-2,2-diphenylacetate |
| SMILES | C=C(C)COC(=O)C(/N=C/c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-20(2)19-28-24(27)25(22-14-8-4-9-15-22,23-16-10-5-11-17-23)26-18-21-12-6-3-7-13-21/h3-18H,1,19H2,2H3/b26-18+ |
| InChIKey | FDULTCAGOCTTNY-NLRVBDNBSA-N |
| XLogP | 5.17 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|