C14H17NO2S — CID 86196794
methyl 2-(benzylideneamino)-3-prop-2-enylsulfanylpropanoate (PubChem CID 86196794) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-(benzylideneamino)-3-prop-2-enylsulfanylpropanoate.
| Compound Name | methyl 2-(benzylideneamino)-3-prop-2-enylsulfanylpropanoate |
|---|---|
| PubChem CID | 86196794 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl 2-(benzylideneamino)-3-prop-2-enylsulfanylpropanoate |
| SMILES | C=CCSCC(/N=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C14H17NO2S/c1-3-9-18-11-13(14(16)17-2)15-10-12-7-5-4-6-8-12/h3-8,10,13H,1,9,11H2,2H3/b15-10+ |
| InChIKey | SRYKKJIFGOYCBZ-XNTDXEJSSA-N |
| XLogP | 2.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|