C19H20BrNO4 — CID 10386599
methyl 2-(benzylideneamino)-3-(2-bromo-3,4-dimethoxyphenyl)propanoate (PubChem CID 10386599) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is methyl 2-(benzylideneamino)-3-(2-bromo-3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl 2-(benzylideneamino)-3-(2-bromo-3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 10386599 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | methyl 2-(benzylideneamino)-3-(2-bromo-3,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC)c(OC)c1Br)/N=C/c1ccccc1 |
| InChI | InChI=1S/C19H20BrNO4/c1-23-16-10-9-14(17(20)18(16)24-2)11-15(19(22)25-3)21-12-13-7-5-4-6-8-13/h4-10,12,15H,11H2,1-3H3/b21-12+ |
| InChIKey | SLCKENLHSUABCY-CIAFOILYSA-N |
| XLogP | 3.67 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|