C20H22BrNO2 — CID 101250740
tert-butyl (2S)-2-(benzylideneamino)-3-(2-bromophenyl)propanoate (PubChem CID 101250740) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzylideneamino)-3-(2-bromophenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzylideneamino)-3-(2-bromophenyl)propanoate |
|---|---|
| PubChem CID | 101250740 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | tert-butyl (2S)-2-(benzylideneamino)-3-(2-bromophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1Br)/N=C/c1ccccc1 |
| InChI | InChI=1S/C20H22BrNO2/c1-20(2,3)24-19(23)18(13-16-11-7-8-12-17(16)21)22-14-15-9-5-4-6-10-15/h4-12,14,18H,13H2,1-3H3/b22-14+/t18-/m0/s1 |
| InChIKey | PUZJRTNLBGAKAY-OVBDPADQSA-N |
| XLogP | 4.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|