C16H22BrNO2 — CID 174771719
tert-butyl (4R)-5-(2-bromophenyl)-2-imino-4-methylpentanoate (PubChem CID 174771719) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is tert-butyl (4R)-5-(2-bromophenyl)-2-imino-4-methylpentanoate.
| Compound Name | tert-butyl (4R)-5-(2-bromophenyl)-2-imino-4-methylpentanoate |
|---|---|
| PubChem CID | 174771719 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | tert-butyl (4R)-5-(2-bromophenyl)-2-imino-4-methylpentanoate |
| SMILES | [H]/N=C(/C[C@H](C)Cc1ccccc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22BrNO2/c1-11(9-12-7-5-6-8-13(12)17)10-14(18)15(19)20-16(2,3)4/h5-8,11,18H,9-10H2,1-4H3/b18-14-/t11-/m1/s1 |
| InChIKey | YCGHMTQUQKPYHZ-GMVXBXSFSA-N |
| XLogP | 4.38 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|