C16H20FNO4 — CID 174715179
2-[(4-fluorophenyl)methyl]-4-imino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 174715179) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-imino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-imino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174715179 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-imino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | [H]/N=C(/CC(Cc1ccc(F)cc1)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20FNO4/c1-16(2,3)22-15(21)13(18)9-11(14(19)20)8-10-4-6-12(17)7-5-10/h4-7,11,18H,8-9H2,1-3H3,(H,19,20)/b18-13- |
| InChIKey | VLYFCIYLSJGBGC-AQTBWJFISA-N |
| XLogP | 2.82 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|