C20H24FN3O3 — CID 174669055
tert-butyl 4-[5-acetyl-4-(4-fluorophenyl)imidazol-1-yl]-2-iminopentanoate (PubChem CID 174669055) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl 4-[5-acetyl-4-(4-fluorophenyl)imidazol-1-yl]-2-iminopentanoate.
| Compound Name | tert-butyl 4-[5-acetyl-4-(4-fluorophenyl)imidazol-1-yl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174669055 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | tert-butyl 4-[5-acetyl-4-(4-fluorophenyl)imidazol-1-yl]-2-iminopentanoate |
| SMILES | [H]/N=C(/CC(C)n1cnc(-c2ccc(F)cc2)c1C(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24FN3O3/c1-12(10-16(22)19(26)27-20(3,4)5)24-11-23-17(18(24)13(2)25)14-6-8-15(21)9-7-14/h6-9,11-12,22H,10H2,1-5H3/b22-16- |
| InChIKey | QNYALLLQXSZDLA-JWGURIENSA-N |
| XLogP | 4.20 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|