C16H23NO5S — CID 174377024
tert-butyl (4R)-2-imino-4-(4-methylphenyl)sulfonyloxypentanoate (PubChem CID 174377024) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl (4R)-2-imino-4-(4-methylphenyl)sulfonyloxypentanoate.
| Compound Name | tert-butyl (4R)-2-imino-4-(4-methylphenyl)sulfonyloxypentanoate |
|---|---|
| PubChem CID | 174377024 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | tert-butyl (4R)-2-imino-4-(4-methylphenyl)sulfonyloxypentanoate |
| SMILES | [H]/N=C(/C[C@@H](C)OS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO5S/c1-11-6-8-13(9-7-11)23(19,20)22-12(2)10-14(17)15(18)21-16(3,4)5/h6-9,12,17H,10H2,1-5H3/b17-14-/t12-/m1/s1 |
| InChIKey | IMEGEBYWIKMMIB-OFWFEXPASA-N |
| XLogP | 2.84 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|