C21H20FN7S — CID 175276335
4-[5-(4-fluorophenyl)-3-[4-imino-5-(1,3-thiazol-5-yl)pentan-2-yl]imidazol-4-yl]pyrimidin-2-amine (PubChem CID 175276335) has the molecular formula C21H20FN7S and a molecular weight of 421.51 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-3-[4-imino-5-(1,3-thiazol-5-yl)pentan-2-yl]imidazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-3-[4-imino-5-(1,3-thiazol-5-yl)pentan-2-yl]imidazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175276335 |
| Molecular Formula | C21H20FN7S |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-[4-imino-5-(1,3-thiazol-5-yl)pentan-2-yl]imidazol-4-yl]pyrimidin-2-amine |
| SMILES | [H]/N=C(\Cc1cncs1)CC(C)n1cnc(-c2ccc(F)cc2)c1-c1ccnc(N)n1 |
| InChI | InChI=1S/C21H20FN7S/c1-13(8-16(23)9-17-10-25-12-30-17)29-11-27-19(14-2-4-15(22)5-3-14)20(29)18-6-7-26-21(24)28-18/h2-7,10-13,23H,8-9H2,1H3,(H2,24,26,28)/b23-16- |
| InChIKey | HVDRLRKTJYTZFX-KQWNVCNZSA-N |
| XLogP | 4.40 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|