C18H12FN5O9S4 — CID 57132637
6-[5-(2-aminopyrimidin-4-yl)-4-(4-fluorophenyl)imidazol-1-yl]-4-sulfonylpyran-2,3,5-trisulfinic acid (PubChem CID 57132637) has the molecular formula C18H12FN5O9S4 and a molecular weight of 589.59 g/mol. Its IUPAC name is 6-[5-(2-aminopyrimidin-4-yl)-4-(4-fluorophenyl)imidazol-1-yl]-4-sulfonylpyran-2,3,5-trisulfinic acid.
| Compound Name | 6-[5-(2-aminopyrimidin-4-yl)-4-(4-fluorophenyl)imidazol-1-yl]-4-sulfonylpyran-2,3,5-trisulfinic acid |
|---|---|
| PubChem CID | 57132637 |
| Molecular Formula | C18H12FN5O9S4 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 588.95 |
| IUPAC Name | 6-[5-(2-aminopyrimidin-4-yl)-4-(4-fluorophenyl)imidazol-1-yl]-4-sulfonylpyran-2,3,5-trisulfinic acid |
| SMILES | Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2-c2oc(S(=O)O)c(S(=O)O)c(=S(=O)=O)c2S(=O)O)n1 |
| InChI | InChI=1S/C18H12FN5O9S4/c19-9-3-1-8(2-4-9)11-12(10-5-6-21-18(20)23-10)24(7-22-11)16-14(35(27)28)13(34(25)26)15(36(29)30)17(33-16)37(31)32/h1-7H,(H,27,28)(H,29,30)(H,31,32)(H2,20,21,23) |
| InChIKey | UVRJKQONVLZFFJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 228.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|