C22H15FN6 — CID 174293805
4-[5-(4-fluorophenyl)-3-quinolin-3-ylimidazol-4-yl]pyrimidin-2-amine (PubChem CID 174293805) has the molecular formula C22H15FN6 and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-3-quinolin-3-ylimidazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-3-quinolin-3-ylimidazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 174293805 |
| Molecular Formula | C22H15FN6 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-quinolin-3-ylimidazol-4-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2-c2cnc3ccccc3c2)n1 |
| InChI | InChI=1S/C22H15FN6/c23-16-7-5-14(6-8-16)20-21(19-9-10-25-22(24)28-19)29(13-27-20)17-11-15-3-1-2-4-18(15)26-12-17/h1-13H,(H2,24,25,28) |
| InChIKey | KWSWVIHIBXWFLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |