C20H26FN5OSSi — CID 154633131
4-[5-(4-fluorophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrimidin-2-amine (PubChem CID 154633131) has the molecular formula C20H26FN5OSSi and a molecular weight of 431.61 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 154633131 |
| Molecular Formula | C20H26FN5OSSi |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrimidin-2-amine |
| SMILES | CSc1nc(-c2ccc(F)cc2)c(-c2ccnc(N)n2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26FN5OSSi/c1-28-20-25-17(14-5-7-15(21)8-6-14)18(16-9-10-23-19(22)24-16)26(20)13-27-11-12-29(2,3)4/h5-10H,11-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | FUMFWHPZZDCWNC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|