C30H33F2N5O3SSi — CID 163228526
N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3,5-difluorobenzamide (PubChem CID 163228526) has the molecular formula C30H33F2N5O3SSi and a molecular weight of 609.78 g/mol. Its IUPAC name is N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3,5-difluorobenzamide.
| Compound Name | N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 163228526 |
| Molecular Formula | C30H33F2N5O3SSi |
| Molecular Weight | 609.78 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3,5-difluorobenzamide |
| SMILES | CSc1nc(-c2cccc(NC(=O)c3cc(F)cc(F)c3)c2)c(-c2ccnc(NC(C)=O)c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H33F2N5O3SSi/c1-19(38)34-26-16-21(9-10-33-26)28-27(36-30(41-2)37(28)18-40-11-12-42(3,4)5)20-7-6-8-25(15-20)35-29(39)22-13-23(31)17-24(32)14-22/h6-10,13-17H,11-12,18H2,1-5H3,(H,35,39)(H,33,34,38) |
| InChIKey | IQJHPSPCNUEPHO-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|