C32H39N5O3SSi — CID 163228548
N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3-phenylpropanamide (PubChem CID 163228548) has the molecular formula C32H39N5O3SSi and a molecular weight of 601.85 g/mol. Its IUPAC name is N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 163228548 |
| Molecular Formula | C32H39N5O3SSi |
| Molecular Weight | 601.85 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | N-[3-[5-(2-acetamido-4-pyridinyl)-2-methylsulfanyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]phenyl]-3-phenylpropanamide |
| SMILES | CSc1nc(-c2cccc(NC(=O)CCc3ccccc3)c2)c(-c2ccnc(NC(C)=O)c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C32H39N5O3SSi/c1-23(38)34-28-21-26(16-17-33-28)31-30(36-32(41-2)37(31)22-40-18-19-42(3,4)5)25-12-9-13-27(20-25)35-29(39)15-14-24-10-7-6-8-11-24/h6-13,16-17,20-21H,14-15,18-19,22H2,1-5H3,(H,35,39)(H,33,34,38) |
| InChIKey | YGJVGEFHQFCPSA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.85 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|