C23H31N5O2SSi — CID 163228511
N-[4-[5-(2-aminophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-pyridinyl]acetamide (PubChem CID 163228511) has the molecular formula C23H31N5O2SSi and a molecular weight of 469.69 g/mol. Its IUPAC name is N-[4-[5-(2-aminophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[5-(2-aminophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 163228511 |
| Molecular Formula | C23H31N5O2SSi |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4-[5-(2-aminophenyl)-2-methylsulfanyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-pyridinyl]acetamide |
| SMILES | CSc1nc(-c2ccccc2N)c(-c2ccnc(NC(C)=O)c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H31N5O2SSi/c1-16(29)26-20-14-17(10-11-25-20)22-21(18-8-6-7-9-19(18)24)27-23(31-2)28(22)15-30-12-13-32(3,4)5/h6-11,14H,12-13,15,24H2,1-5H3,(H,25,26,29) |
| InChIKey | YCOOSMGAHZUGJL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|