C28H30F3N5O4Si — CID 140726710
N-[4-[3-(5-methoxy-2-pyridinyl)-6-(2,2,2-trifluoroacetyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide (PubChem CID 140726710) has the molecular formula C28H30F3N5O4Si and a molecular weight of 585.66 g/mol. Its IUPAC name is N-[4-[3-(5-methoxy-2-pyridinyl)-6-(2,2,2-trifluoroacetyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[3-(5-methoxy-2-pyridinyl)-6-(2,2,2-trifluoroacetyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 140726710 |
| Molecular Formula | C28H30F3N5O4Si |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | N-[4-[3-(5-methoxy-2-pyridinyl)-6-(2,2,2-trifluoroacetyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]-2-pyridinyl]acetamide |
| SMILES | COc1ccc(-c2c(-c3ccnc(NC(C)=O)c3)n(COCC[Si](C)(C)C)c3cc(C(=O)C(F)(F)F)cnc23)nc1 |
| InChI | InChI=1S/C28H30F3N5O4Si/c1-17(37)35-23-13-18(8-9-32-23)26-24(21-7-6-20(39-2)15-33-21)25-22(36(26)16-40-10-11-41(3,4)5)12-19(14-34-25)27(38)28(29,30)31/h6-9,12-15H,10-11,16H2,1-5H3,(H,32,35,37) |
| InChIKey | SKYNRFICDLTKNF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|